C18H27F3N2O4S — CID 127022391
(3S,3aS,7aR)-3-(2-methylpropoxy)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127022391) has the molecular formula C18H27F3N2O4S and a molecular weight of 424.49 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-(2-methylpropoxy)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aS,7aR)-3-(2-methylpropoxy)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022391 |
| Molecular Formula | C18H27F3N2O4S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (3S,3aS,7aR)-3-(2-methylpropoxy)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncsc1CN1C[C@H](OCC(C)C)[C@H]2OCCC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N2O2S.C2HF3O2/c1-11(2)9-20-14-7-18(8-15-12(3)17-10-21-15)13-5-4-6-19-16(13)14;3-2(4,5)1(6)7/h10-11,13-14,16H,4-9H2,1-3H3;(H,6,7)/t13-,14+,16+;/m1./s1 |
| InChIKey | OGMJGSFURGZGGB-FNIUFUSKSA-N |
| XLogP | 3.49 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |