C18H26F3N3O6S2 — CID 127022421
ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 127022421) has the molecular formula C18H26F3N3O6S2 and a molecular weight of 501.55 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022421 |
| Molecular Formula | C18H26F3N3O6S2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3nccs3)C[C@H]1CN(S(C)(=O)=O)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O4S2.C2HF3O2/c1-3-23-15(20)16-5-4-7-18(11-14-17-6-8-24-14)9-13(16)10-19(12-16)25(2,21)22;3-2(4,5)1(6)7/h6,8,13H,3-5,7,9-12H2,1-2H3;(H,6,7)/t13-,16-;/m0./s1 |
| InChIKey | VQINIVFXERBGHI-LINSIKMZSA-N |
| XLogP | 1.81 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |