C22H28F9N3O8 — CID 127022522
(5aS,8aS)-4-(2-methoxyethyl)-7-(pyridin-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;tris(2,2,2-trifluoroacetic acid) (PubChem CID 127022522) has the molecular formula C22H28F9N3O8 and a molecular weight of 633.46 g/mol. Its IUPAC name is (5aS,8aS)-4-(2-methoxyethyl)-7-(pyridin-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;tris(2,2,2-trifluoroacetic acid).
| Compound Name | (5aS,8aS)-4-(2-methoxyethyl)-7-(pyridin-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022522 |
| Molecular Formula | C22H28F9N3O8 |
| Molecular Weight | 633.46 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | (5aS,8aS)-4-(2-methoxyethyl)-7-(pyridin-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;tris(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1CCO[C@@H]2CN(Cc3ccccn3)C[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O2.3C2HF3O2/c1-20-8-6-18-7-9-21-16-13-19(11-14(16)10-18)12-15-4-2-3-5-17-15;3*3-2(4,5)1(6)7/h2-5,14,16H,6-13H2,1H3;3*(H,6,7)/t14-,16+;;;/m0.../s1 |
| InChIKey | DZUGSPRJSBBLLO-LNTXITHQSA-N |
| XLogP | 2.76 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |