C22H31F9N4O7 — CID 127022530
(3R,3aS,7aR)-N,N-diethyl-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) (PubChem CID 127022530) has the molecular formula C22H31F9N4O7 and a molecular weight of 634.49 g/mol. Its IUPAC name is (3R,3aS,7aR)-N,N-diethyl-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,7aR)-N,N-diethyl-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022530 |
| Molecular Formula | C22H31F9N4O7 |
| Molecular Weight | 634.49 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | (3R,3aS,7aR)-N,N-diethyl-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine;tris(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)[C@@H]1CN(Cc2nccn2C)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H28N4O.3C2HF3O2/c1-4-19(5-2)14-11-20(12-15-17-8-9-18(15)3)13-7-6-10-21-16(13)14;3*3-2(4,5)1(6)7/h8-9,13-14,16H,4-7,10-12H2,1-3H3;3*(H,6,7)/t13-,14-,16+;;;/m1.../s1 |
| InChIKey | UMODXVGCZYYOGH-SLTQNGQHSA-N |
| XLogP | 3.39 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |