C19H18F4N4O4 — CID 127022600
[(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(4-fluorophenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127022600) has the molecular formula C19H18F4N4O4 and a molecular weight of 442.37 g/mol. Its IUPAC name is [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(4-fluorophenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(4-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022600 |
| Molecular Formula | C19H18F4N4O4 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(4-fluorophenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccc(F)cc1)N1C[C@@H]2OCCN(c3ncccn3)[C@@H]2C1 |
| InChI | InChI=1S/C17H17FN4O2.C2HF3O2/c18-13-4-2-12(3-5-13)16(23)21-10-14-15(11-21)24-9-8-22(14)17-19-6-1-7-20-17;3-2(4,5)1(6)7/h1-7,14-15H,8-11H2;(H,6,7)/t14-,15+;/m1./s1 |
| InChIKey | QZOPZLVNTFXEMH-LIOBNPLQSA-N |
| XLogP | 1.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |