C21H30F3N3O5 — CID 127022641
(3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022641) has the molecular formula C21H30F3N3O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022641 |
| Molecular Formula | C21H30F3N3O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1CC[C@H]2OCC[C@@]2(C(=O)NC2CCCC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29N3O3.C2HF3O2/c1-13-16(14(2)25-21-13)11-22-9-7-17-19(12-22,8-10-24-17)18(23)20-15-5-3-4-6-15;3-2(4,5)1(6)7/h15,17H,3-12H2,1-2H3,(H,20,23);(H,6,7)/t17-,19-;/m1./s1 |
| InChIKey | FINOHJAFGWZFQY-POCMBTLOSA-N |
| XLogP | 2.96 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |