C14H17F3N2O5 — CID 127022642
[(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127022642) has the molecular formula C14H17F3N2O5 and a molecular weight of 350.29 g/mol. Its IUPAC name is [(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022642 |
| Molecular Formula | C14H17F3N2O5 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCO[C@H]2CN(C(=O)c3ccoc3)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16N2O3.C2HF3O2/c1-13-3-5-17-11-7-14(6-10(11)13)12(15)9-2-4-16-8-9;3-2(4,5)1(6)7/h2,4,8,10-11H,3,5-7H2,1H3;(H,6,7)/t10-,11+;/m1./s1 |
| InChIKey | LALFLBXYYQGZJF-DHXVBOOMSA-N |
| XLogP | 1.07 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |