C17H22F6N4O5S — CID 127022672
(2S,3aS,6aS)-N,1-dimethyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022672) has the molecular formula C17H22F6N4O5S and a molecular weight of 508.44 g/mol. Its IUPAC name is (2S,3aS,6aS)-N,1-dimethyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S,3aS,6aS)-N,1-dimethyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022672 |
| Molecular Formula | C17H22F6N4O5S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2S,3aS,6aS)-N,1-dimethyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)[C@@H]1C[C@H]2CN(Cc3nccs3)C[C@H]2N1C.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N4OS.2C2HF3O2/c1-14-13(18)10-5-9-6-17(7-11(9)16(10)2)8-12-15-3-4-19-12;2*3-2(4,5)1(6)7/h3-4,9-11H,5-8H2,1-2H3,(H,14,18);2*(H,6,7)/t9-,10-,11+;;/m0../s1 |
| InChIKey | RPVVWFKQCPGWOS-MTFBGNCFSA-N |
| XLogP | 1.66 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |