C19H24F4N4O4 — CID 127022774
(3aR,5R,7aR)-N-cyclopentyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022774) has the molecular formula C19H24F4N4O4 and a molecular weight of 448.42 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-cyclopentyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-cyclopentyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022774 |
| Molecular Formula | C19H24F4N4O4 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3aR,5R,7aR)-N-cyclopentyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CCCC1)[C@H]1CC[C@@H]2[C@@H](CCN2c2ncc(F)cn2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23FN4O2.C2HF3O2/c18-11-9-19-17(20-10-11)22-8-7-14-13(22)5-6-15(24-14)16(23)21-12-3-1-2-4-12;3-2(4,5)1(6)7/h9-10,12-15H,1-8H2,(H,21,23);(H,6,7)/t13-,14-,15-;/m1./s1 |
| InChIKey | NNYTUUAKWISWQT-RFMLDLTKSA-N |
| XLogP | 2.43 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |