C21H24F6N4O6S — CID 127022829
(3R,3aR,6aS)-1-(5-ethylpyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022829) has the molecular formula C21H24F6N4O6S and a molecular weight of 574.50 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-(5-ethylpyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aR,6aS)-1-(5-ethylpyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022829 |
| Molecular Formula | C21H24F6N4O6S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | (3R,3aR,6aS)-1-(5-ethylpyrimidin-2-yl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1cnc(N2C[C@H](OCc3csc(C)n3)[C@H]3COC[C@H]32)nc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4O2S.2C2HF3O2/c1-3-12-4-18-17(19-5-12)21-6-16(14-8-22-9-15(14)21)23-7-13-10-24-11(2)20-13;2*3-2(4,5)1(6)7/h4-5,10,14-16H,3,6-9H2,1-2H3;2*(H,6,7)/t14-,15+,16-;;/m0../s1 |
| InChIKey | UCADFKFXMHTPRD-GHDHQEDTSA-N |
| XLogP | 3.49 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |