C17H22F6N2O6S — CID 127022837
(3R,3aS,7aR)-3-methoxy-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022837) has the molecular formula C17H22F6N2O6S and a molecular weight of 496.43 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-methoxy-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,3aS,7aR)-3-methoxy-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022837 |
| Molecular Formula | C17H22F6N2O6S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (3R,3aS,7aR)-3-methoxy-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CO[C@@H]1CN(Cc2scnc2C)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N2O2S.2C2HF3O2/c1-9-12(18-8-14-9)7-15-6-11(16-2)13-10(15)4-3-5-17-13;2*3-2(4,5)1(6)7/h8,10-11,13H,3-7H2,1-2H3;2*(H,6,7)/t10-,11-,13+;;/m1../s1 |
| InChIKey | CTLJTYYZNPMMNY-FMRIHTHOSA-N |
| XLogP | 3.10 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |