About 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole
2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole (PubChem CID 12702286) has the molecular formula C11H10S2
and a molecular weight of 206.34 g/mol. Its IUPAC name is 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole.
Molecular Properties
| Compound Name | 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole |
| PubChem CID | 12702286 |
| Molecular Formula | C11H10S2 |
| Molecular Weight | 206.34 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole |
| SMILES | CC1Cc2c(sc3ccccc23)S1 |
| InChI | InChI=1S/C11H10S2/c1-7-6-9-8-4-2-3-5-10(8)13-11(9)12-7/h2-5,7H,6H2,1H3 |
| InChIKey | WKZUSZJIDCATPS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole?
The IUPAC name of 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole (CID 12702286) is 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole.
What is the SMILES notation for 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole?
The canonical SMILES for 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole is CC1Cc2c(sc3ccccc23)S1.
What is the InChIKey of 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole?
The InChIKey is WKZUSZJIDCATPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S2/c1-7-6-9-8-4-2-3-5-10(8)13-11(9)12-7/h2-5,7H,6H2,1H3.
What are the key properties of 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole?
2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole has a molecular weight of 206.34 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2-dihydrothieno[2,3-b][1]benzothiole is sourced from PubChem (CID 12702286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).