C19H26F3N3O5S — CID 127022920
(2S,3aR,6aR)-N-(oxan-4-ylmethyl)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022920) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is (2S,3aR,6aR)-N-(oxan-4-ylmethyl)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aR,6aR)-N-(oxan-4-ylmethyl)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022920 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (2S,3aR,6aR)-N-(oxan-4-ylmethyl)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CCOCC1)[C@@H]1C[C@@H]2[C@@H](CCN2Cc2nccs2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3S.C2HF3O2/c21-17(19-10-12-2-6-22-7-3-12)15-9-13-14(23-15)1-5-20(13)11-16-18-4-8-24-16;3-2(4,5)1(6)7/h4,8,12-15H,1-3,5-7,9-11H2,(H,19,21);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | IVPPKNAFAHLFAR-QRWISWEOSA-N |
| XLogP | 2.05 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |