C19H29F3N2O5 — CID 127022953
[(3aR,7aR)-5-cyclohexyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127022953) has the molecular formula C19H29F3N2O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is [(3aR,7aR)-5-cyclohexyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aR)-5-cyclohexyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022953 |
| Molecular Formula | C19H29F3N2O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [(3aR,7aR)-5-cyclohexyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-(1,2-oxazolidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N1CCCO1)[C@@]12CCO[C@@H]1CCN(C1CCCCC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N2O3.C2HF3O2/c20-16(19-9-4-11-22-19)17-8-12-21-15(17)7-10-18(13-17)14-5-2-1-3-6-14;3-2(4,5)1(6)7/h14-15H,1-13H2;(H,6,7)/t15-,17-;/m1./s1 |
| InChIKey | KJLFYDCDSXSFMQ-SSPJITILSA-N |
| XLogP | 2.60 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |