C18H23F3N4O5 — CID 127022963
[(3aR,5S,7aR)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127022963) has the molecular formula C18H23F3N4O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is [(3aR,5S,7aR)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,5S,7aR)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022963 |
| Molecular Formula | C18H23F3N4O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(3aR,5S,7aR)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@@H]1CC[C@@H]2[C@@H](CCN2c2ccncn2)O1)N1CCCCO1 |
| InChI | InChI=1S/C16H22N4O3.C2HF3O2/c21-16(20-8-1-2-10-22-20)14-4-3-12-13(23-14)6-9-19(12)15-5-7-17-11-18-15;3-2(4,5)1(6)7/h5,7,11-14H,1-4,6,8-10H2;(H,6,7)/t12-,13-,14+;/m1./s1 |
| InChIKey | KZHPEYCTBJCGQW-NNNATCHMSA-N |
| XLogP | 1.79 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |