C20H31F3N4O4 — CID 127022993
N-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 127022993) has the molecular formula C20H31F3N4O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022993 |
| Molecular Formula | C20H31F3N4O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | COCCN(C)C[C@@H]1CCC[C@@H]2CN(c3cc(OC)ncn3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H30N4O2.C2HF3O2/c1-21(7-8-23-2)10-14-5-4-6-15-11-22(12-16(14)15)17-9-18(24-3)20-13-19-17;3-2(4,5)1(6)7/h9,13-16H,4-8,10-12H2,1-3H3;(H,6,7)/t14-,15+,16+;/m0./s1 |
| InChIKey | DOVZARMDTDAJDH-FUQNERGOSA-N |
| XLogP | 2.55 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |