C22H23F6N3O5S — CID 127023026
(3aS,6aS)-4-[(6-methyl-2-pyridinyl)methyl]-1-(thiophen-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023026) has the molecular formula C22H23F6N3O5S and a molecular weight of 555.50 g/mol. Its IUPAC name is (3aS,6aS)-4-[(6-methyl-2-pyridinyl)methyl]-1-(thiophen-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,6aS)-4-[(6-methyl-2-pyridinyl)methyl]-1-(thiophen-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023026 |
| Molecular Formula | C22H23F6N3O5S |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | (3aS,6aS)-4-[(6-methyl-2-pyridinyl)methyl]-1-(thiophen-2-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cccc(CN2C(=O)C[C@H]3[C@@H]2CCN3Cc2cccs2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3OS.2C2HF3O2/c1-13-4-2-5-14(19-13)11-21-16-7-8-20(17(16)10-18(21)22)12-15-6-3-9-23-15;2*3-2(4,5)1(6)7/h2-6,9,16-17H,7-8,10-12H2,1H3;2*(H,6,7)/t16-,17-;;/m0../s1 |
| InChIKey | FWHVWOSJXXQUFL-SZKOKKDDSA-N |
| XLogP | 4.09 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |