C18H25F3N4O4S — CID 127023130
N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyrrolidine-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127023130) has the molecular formula C18H25F3N4O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyrrolidine-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyrrolidine-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023130 |
| Molecular Formula | C18H25F3N4O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]pyrrolidine-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@]12COC[C@H]1CN(Cc1nccs1)C2)N1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2S.C2HF3O2/c21-15(20-4-1-2-5-20)18-10-16-11-19(7-13(16)9-22-12-16)8-14-17-3-6-23-14;3-2(4,5)1(6)7/h3,6,13H,1-2,4-5,7-12H2,(H,18,21);(H,6,7)/t13-,16+;/m1./s1 |
| InChIKey | IDWIAHSNRUIBHJ-CACIRBSMSA-N |
| XLogP | 2.03 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |