C20H25F6N3O7S — CID 127023200
[(3aS,4R,7aS)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023200) has the molecular formula C20H25F6N3O7S and a molecular weight of 565.49 g/mol. Its IUPAC name is [(3aS,4R,7aS)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aS,4R,7aS)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023200 |
| Molecular Formula | C20H25F6N3O7S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [(3aS,4R,7aS)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-4-yl]-(oxazinan-2-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C([C@H]1CN(Cc2nccs2)C[C@H]2OCC[C@@H]12)N1CCCCO1 |
| InChI | InChI=1S/C16H23N3O3S.2C2HF3O2/c20-16(19-5-1-2-6-22-19)13-9-18(11-15-17-4-8-23-15)10-14-12(13)3-7-21-14;2*3-2(4,5)1(6)7/h4,8,12-14H,1-3,5-7,9-11H2;2*(H,6,7)/t12-,13-,14+;;/m0../s1 |
| InChIKey | KSXIBTREQLKZET-HTTVLNLHSA-N |
| XLogP | 2.80 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |