C20H31F3N4O4S — CID 127023286
(3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 127023286) has the molecular formula C20H31F3N4O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023286 |
| Molecular Formula | C20H31F3N4O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (3aR,8aR)-6-(5-ethylpyrimidin-2-yl)-2-(3-methylbutyl)-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cnc(N2CC[C@@H]3CN(CCC(C)C)S(=O)(=O)[C@@H]3CC2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H30N4O2S.C2HF3O2/c1-4-15-11-19-18(20-12-15)21-8-6-16-13-22(10-5-14(2)3)25(23,24)17(16)7-9-21;3-2(4,5)1(6)7/h11-12,14,16-17H,4-10,13H2,1-3H3;(H,6,7)/t16-,17-;/m1./s1 |
| InChIKey | HAJVZXXPTMFTGY-GBNZRNLASA-N |
| XLogP | 2.95 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |