C19H24F3N5O3S — CID 127023305
4-[(4aR,7aS)-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylpyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 127023305) has the molecular formula C19H24F3N5O3S and a molecular weight of 459.49 g/mol. Its IUPAC name is 4-[(4aR,7aS)-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylpyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(4aR,7aS)-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylpyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023305 |
| Molecular Formula | C19H24F3N5O3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-[(4aR,7aS)-6-(thiophen-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylpyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1nccc(N2CCO[C@H]3CN(Cc4ccsc4)C[C@H]32)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N5OS.C2HF3O2/c1-20(2)17-18-5-3-16(19-17)22-6-7-23-15-11-21(10-14(15)22)9-13-4-8-24-12-13;3-2(4,5)1(6)7/h3-5,8,12,14-15H,6-7,9-11H2,1-2H3;(H,6,7)/t14-,15+;/m1./s1 |
| InChIKey | XLDCMNSOHUIYCU-LIOBNPLQSA-N |
| XLogP | 2.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |