C18H25F3N2O5S — CID 127023313
(3R,3aR,6aS)-3-(oxan-4-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127023313) has the molecular formula C18H25F3N2O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-(oxan-4-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-3-(oxan-4-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023313 |
| Molecular Formula | C18H25F3N2O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (3R,3aR,6aS)-3-(oxan-4-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2C[C@H](OCC3CCOCC3)[C@H]3COC[C@H]32)n1 |
| InChI | InChI=1S/C16H24N2O3S.C2HF3O2/c1-4-19-5-2-12(1)9-21-15-7-18(8-16-17-3-6-22-16)14-11-20-10-13(14)15;3-2(4,5)1(6)7/h3,6,12-15H,1-2,4-5,7-11H2;(H,6,7)/t13-,14+,15-;/m0./s1 |
| InChIKey | JRRGWEPQYYUWAC-HWKASLJMSA-N |
| XLogP | 2.42 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |