C21H27F6N5O6 — CID 127023357
[(3aR,5S,7aR)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023357) has the molecular formula C21H27F6N5O6 and a molecular weight of 559.46 g/mol. Its IUPAC name is [(3aR,5S,7aR)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aR,5S,7aR)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023357 |
| Molecular Formula | C21H27F6N5O6 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | [(3aR,5S,7aR)-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperazin-1-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(C(=O)[C@@H]2CC[C@@H]3[C@@H](CCN3c3ncccn3)O2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5O2.2C2HF3O2/c1-20-9-11-21(12-10-20)16(23)15-4-3-13-14(24-15)5-8-22(13)17-18-6-2-7-19-17;2*3-2(4,5)1(6)7/h2,6-7,13-15H,3-5,8-12H2,1H3;2*(H,6,7)/t13-,14-,15+;;/m1../s1 |
| InChIKey | JKXOVZBNLFXSHA-RUGWIRSISA-N |
| XLogP | 1.64 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |