C18H25FN2O2 — CID 127023383
(4aR,7aS)-6-[(4-fluorophenyl)methyl]-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 127023383) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is (4aR,7aS)-6-[(4-fluorophenyl)methyl]-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-6-[(4-fluorophenyl)methyl]-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 127023383 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (4aR,7aS)-6-[(4-fluorophenyl)methyl]-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Fc1ccc(CN2C[C@@H]3OCCN(CC4CCCO4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H25FN2O2/c19-15-5-3-14(4-6-15)10-20-12-17-18(13-20)23-9-7-21(17)11-16-2-1-8-22-16/h3-6,16-18H,1-2,7-13H2/t16?,17-,18+/m1/s1 |
| InChIKey | PALNWLICXHTRDF-RWZMTBSZSA-N |
| XLogP | 1.89 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |