C18H24F3N3O5S — CID 127023455
[(2R,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127023455) has the molecular formula C18H24F3N3O5S and a molecular weight of 451.47 g/mol. Its IUPAC name is [(2R,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2R,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023455 |
| Molecular Formula | C18H24F3N3O5S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [(2R,3aS,6aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CC[C@@H]3O[C@@H](C(=O)N4CCOCC4)C[C@@H]32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O3S.C2HF3O2/c1-11-17-12(10-23-11)9-19-3-2-14-13(19)8-15(22-14)16(20)18-4-6-21-7-5-18;3-2(4,5)1(6)7/h10,13-15H,2-9H2,1H3;(H,6,7)/t13-,14-,15+;/m0./s1 |
| InChIKey | BMGQIZHWMFUVIX-UEHWSTJSSA-N |
| XLogP | 1.68 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |