C16H21F3N2O4S — CID 127023506
(3R,3aR,6aS)-3-(cyclopropylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127023506) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-(cyclopropylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-3-(cyclopropylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023506 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3R,3aR,6aS)-3-(cyclopropylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2C[C@H](OCC3CC3)[C@H]3COC[C@H]32)n1 |
| InChI | InChI=1S/C14H20N2O2S.C2HF3O2/c1-2-10(1)7-18-13-5-16(6-14-15-3-4-19-14)12-9-17-8-11(12)13;3-2(4,5)1(6)7/h3-4,10-13H,1-2,5-9H2;(H,6,7)/t11-,12+,13-;/m0./s1 |
| InChIKey | LKNKNFFKXCEKSB-LQQCYJDJSA-N |
| XLogP | 2.40 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |