C24H24F7N3O6 — CID 127023594
[(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-fluorophenyl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023594) has the molecular formula C24H24F7N3O6 and a molecular weight of 583.46 g/mol. Its IUPAC name is [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-fluorophenyl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-fluorophenyl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023594 |
| Molecular Formula | C24H24F7N3O6 |
| Molecular Weight | 583.46 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | [(7R,8aS)-7-(pyridin-2-ylmethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-fluorophenyl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(c1ccc(F)cc1)N1CCN2C[C@H](OCc3ccccn3)C[C@H]2C1 |
| InChI | InChI=1S/C20H22FN3O2.2C2HF3O2/c21-16-6-4-15(5-7-16)20(25)24-10-9-23-13-19(11-18(23)12-24)26-14-17-3-1-2-8-22-17;2*3-2(4,5)1(6)7/h1-8,18-19H,9-14H2;2*(H,6,7)/t18-,19+;;/m0../s1 |
| InChIKey | OXNPBLIKKVPUTE-DPSPSOFVSA-N |
| XLogP | 3.60 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |