C21H27F6N3O6S — CID 127023597
(3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023597) has the molecular formula C21H27F6N3O6S and a molecular weight of 563.52 g/mol. Its IUPAC name is (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023597 |
| Molecular Formula | C21H27F6N3O6S |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NC1CCCC1)[C@@H]1CN(Cc2nccs2)C[C@H]2OCC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O2S.2C2HF3O2/c21-17(19-12-3-1-2-4-12)14-9-20(11-16-18-6-8-23-16)10-15-13(14)5-7-22-15;2*3-2(4,5)1(6)7/h6,8,12-15H,1-5,7,9-11H2,(H,19,21);2*(H,6,7)/t13-,14+,15+;;/m0../s1 |
| InChIKey | ATPXLDXRZGWJGB-ZFSDTUNKSA-N |
| XLogP | 3.31 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |