C16H22F3N3O4S — CID 127023654
(3aR,5S,7aR)-N,N-dimethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127023654) has the molecular formula C16H22F3N3O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is (3aR,5S,7aR)-N,N-dimethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5S,7aR)-N,N-dimethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023654 |
| Molecular Formula | C16H22F3N3O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (3aR,5S,7aR)-N,N-dimethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2nccs2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O2S.C2HF3O2/c1-16(2)14(18)12-4-3-10-11(19-12)5-7-17(10)9-13-15-6-8-20-13;3-2(4,5)1(6)7/h6,8,10-12H,3-5,7,9H2,1-2H3;(H,6,7)/t10-,11-,12+;/m1./s1 |
| InChIKey | HECYGPKNXHNHFK-HSASPSRMSA-N |
| XLogP | 1.99 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |