C20H28F3N3O4S — CID 127023655
[(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127023655) has the molecular formula C20H28F3N3O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023655 |
| Molecular Formula | C20H28F3N3O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCN(C(=O)[C@H]2CC[C@@H]3[C@@H](CCN3Cc3nccs3)O2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O2S.C2HF3O2/c1-13-4-8-20(9-5-13)18(22)16-3-2-14-15(23-16)6-10-21(14)12-17-19-7-11-24-17;3-2(4,5)1(6)7/h7,11,13-16H,2-6,8-10,12H2,1H3;(H,6,7)/t14-,15-,16-;/m1./s1 |
| InChIKey | DLOYXXYSIJEENZ-UDHFTORSSA-N |
| XLogP | 3.16 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |