C19H28F3N3O4S — CID 127023659
(5S,10S)-10-ethyl-1-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 127023659) has the molecular formula C19H28F3N3O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-1-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,10S)-10-ethyl-1-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023659 |
| Molecular Formula | C19H28F3N3O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (5S,10S)-10-ethyl-1-(2-methoxyethyl)-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H]1N(Cc2nccs2)CCC[C@]12CCC(=O)N2CCOC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2S.C2HF3O2/c1-3-14-17(7-5-16(21)20(17)10-11-22-2)6-4-9-19(14)13-15-18-8-12-23-15;3-2(4,5)1(6)7/h8,12,14H,3-7,9-11,13H2,1-2H3;(H,6,7)/t14-,17-;/m0./s1 |
| InChIKey | CICNSUPYASJLLW-RVXRQPKJSA-N |
| XLogP | 3.16 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |