C16H20F3N3O5S — CID 127023710
(3aR,6aR)-2-(2-methoxyacetyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid (PubChem CID 127023710) has the molecular formula C16H20F3N3O5S and a molecular weight of 423.41 g/mol. Its IUPAC name is (3aR,6aR)-2-(2-methoxyacetyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aR)-2-(2-methoxyacetyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023710 |
| Molecular Formula | C16H20F3N3O5S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (3aR,6aR)-2-(2-methoxyacetyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1C[C@H]2CN(Cc3csc(C)n3)C(=O)[C@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N3O3S.C2HF3O2/c1-9-15-11(8-21-9)5-17-4-10-3-16(13(18)7-20-2)6-12(10)14(17)19;3-2(4,5)1(6)7/h8,10,12H,3-7H2,1-2H3;(H,6,7)/t10-,12-;/m0./s1 |
| InChIKey | JYLIRLPBXVEBFF-JGAZGGJJSA-N |
| XLogP | 1.15 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |