C17H24F3N3O3S — CID 127023807
(5S,10S)-10-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 127023807) has the molecular formula C17H24F3N3O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,10S)-10-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023807 |
| Molecular Formula | C17H24F3N3O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (5S,10S)-10-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H]1N(Cc2nccs2)CCC[C@]12CCC(=O)N2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3OS.C2HF3O2/c1-3-12-15(7-5-14(19)17(15)2)6-4-9-18(12)11-13-16-8-10-20-13;3-2(4,5)1(6)7/h8,10,12H,3-7,9,11H2,1-2H3;(H,6,7)/t12-,15-;/m0./s1 |
| InChIKey | GOGQVSKERZQEJL-NXCSSKFKSA-N |
| XLogP | 3.14 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |