C17H23F3N4O4 — CID 127023810
1-[(3aR,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-ethoxyethanone;2,2,2-trifluoroacetic acid (PubChem CID 127023810) has the molecular formula C17H23F3N4O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is 1-[(3aR,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-ethoxyethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aR,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-ethoxyethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023810 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[(3aR,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-2-ethoxyethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC(=O)N1C[C@@H]2CCN(c3cnccn3)C[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O2.C2HF3O2/c1-2-21-11-15(20)19-8-12-3-6-18(9-13(12)10-19)14-7-16-4-5-17-14;3-2(4,5)1(6)7/h4-5,7,12-13H,2-3,6,8-11H2,1H3;(H,6,7)/t12-,13+;/m0./s1 |
| InChIKey | PJZLNHZZIZQZHL-JHEYCYPBSA-N |
| XLogP | 1.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |