C16H25F3N4O5S — CID 127023855
(5aS,8aS)-7-ethylsulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;2,2,2-trifluoroacetic acid (PubChem CID 127023855) has the molecular formula C16H25F3N4O5S and a molecular weight of 442.46 g/mol. Its IUPAC name is (5aS,8aS)-7-ethylsulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;2,2,2-trifluoroacetic acid.
| Compound Name | (5aS,8aS)-7-ethylsulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023855 |
| Molecular Formula | C16H25F3N4O5S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (5aS,8aS)-7-ethylsulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1C[C@@H]2CN(Cc3cnn(C)c3)CCO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H24N4O3S.C2HF3O2/c1-3-22(19,20)18-10-13-9-17(4-5-21-14(13)11-18)8-12-6-15-16(2)7-12;3-2(4,5)1(6)7/h6-7,13-14H,3-5,8-11H2,1-2H3;(H,6,7)/t13-,14+;/m0./s1 |
| InChIKey | CDSYQJQJIVFCTG-LMRHVHIWSA-N |
| XLogP | 0.54 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |