C16H22F3N3O5S — CID 127023874
2-[[(3R,3aR,6aS)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 127023874) has the molecular formula C16H22F3N3O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is 2-[[(3R,3aR,6aS)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3R,3aR,6aS)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023874 |
| Molecular Formula | C16H22F3N3O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[[(3R,3aR,6aS)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CO[C@H]1CN(Cc2nccs2)[C@@H]2COC[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O3S.C2HF3O2/c1-16(2)14(18)9-20-12-5-17(6-13-15-3-4-21-13)11-8-19-7-10(11)12;3-2(4,5)1(6)7/h3-4,10-12H,5-9H2,1-2H3;(H,6,7)/t10-,11+,12-;/m0./s1 |
| InChIKey | GLJKUHQYHJHBOK-XNGOQOFYSA-N |
| XLogP | 1.08 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |