C22H29F3N2O4 — CID 127023881
(3aR,5S,7aR)-N-cyclobutyl-1-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127023881) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-cyclobutyl-1-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5S,7aR)-N-cyclobutyl-1-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023881 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (3aR,5S,7aR)-N-cyclobutyl-1-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CCC1)[C@@H]1CC[C@@H]2[C@@H](CCN2CCc2ccccc2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O2.C2HF3O2/c23-20(21-16-7-4-8-16)19-10-9-17-18(24-19)12-14-22(17)13-11-15-5-2-1-3-6-15;3-2(4,5)1(6)7/h1-3,5-6,16-19H,4,7-14H2,(H,21,23);(H,6,7)/t17-,18-,19+;/m1./s1 |
| InChIKey | SGJRGBZHMHLCFC-HNOOLODWSA-N |
| XLogP | 3.15 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |