C14H18F3N3O4S — CID 127023885
N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127023885) has the molecular formula C14H18F3N3O4S and a molecular weight of 381.38 g/mol. Its IUPAC name is N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023885 |
| Molecular Formula | C14H18F3N3O4S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1C[C@H](NC(=O)c2cscn2)[C@@H]2OCCC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3O2S.C2HF3O2/c1-15-5-8(11-10(15)3-2-4-17-11)14-12(16)9-6-18-7-13-9;3-2(4,5)1(6)7/h6-8,10-11H,2-5H2,1H3,(H,14,16);(H,6,7)/t8-,10-,11-;/m0./s1 |
| InChIKey | FICIBHHJLOWLEL-CPWVZUBPSA-N |
| XLogP | 1.37 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |