C20H27F3N4O5 — CID 127024003
(3aR,5R,7aR)-N-cyclopentyl-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127024003) has the molecular formula C20H27F3N4O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-cyclopentyl-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-cyclopentyl-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024003 |
| Molecular Formula | C20H27F3N4O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (3aR,5R,7aR)-N-cyclopentyl-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2CC[C@H]3O[C@@H](C(=O)NC4CCCC4)CC[C@H]32)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O3.C2HF3O2/c1-24-17-10-16(19-11-20-17)22-9-8-14-13(22)6-7-15(25-14)18(23)21-12-4-2-3-5-12;3-2(4,5)1(6)7/h10-15H,2-9H2,1H3,(H,21,23);(H,6,7)/t13-,14-,15-;/m1./s1 |
| InChIKey | BZRIWDCDVVHKMM-RFMLDLTKSA-N |
| XLogP | 2.30 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |