C21H29F3N2O5S — CID 127024027
2-[(3aR,7S,7aS)-2-[(5-methylthiophen-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 127024027) has the molecular formula C21H29F3N2O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-[(5-methylthiophen-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-[(5-methylthiophen-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024027 |
| Molecular Formula | C21H29F3N2O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-[(5-methylthiophen-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3COC[C@@H](CC(=O)N4CCOCC4)[C@@H]3C2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O3S.C2HF3O2/c1-14-2-3-17(25-14)10-20-9-16-13-24-12-15(18(16)11-20)8-19(22)21-4-6-23-7-5-21;3-2(4,5)1(6)7/h2-3,15-16,18H,4-13H2,1H3;(H,6,7)/t15-,16-,18+;/m1./s1 |
| InChIKey | BTJBBTKILOZRQF-DYYUINESSA-N |
| XLogP | 2.63 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |