C17H19F3N4O4S2 — CID 127024028
N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127024028) has the molecular formula C17H19F3N4O4S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024028 |
| Molecular Formula | C17H19F3N4O4S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@]12COC[C@H]1CN(Cc1nccs1)C2)c1cscn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18N4O2S2.C2HF3O2/c20-14(12-6-22-10-18-12)17-7-15-8-19(3-11(15)5-21-9-15)4-13-16-1-2-23-13;3-2(4,5)1(6)7/h1-2,6,10-11H,3-5,7-9H2,(H,17,20);(H,6,7)/t11-,15+;/m1./s1 |
| InChIKey | MFJNRIKHDBOWFZ-BTAXJDQBSA-N |
| XLogP | 2.11 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |