C22H21F7N6O2 — CID 127024191
N-(2,2-difluoroethyl)-2-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 127024191) has the molecular formula C22H21F7N6O2 and a molecular weight of 534.44 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2,2-difluoroethyl)-2-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024191 |
| Molecular Formula | C22H21F7N6O2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccc(CN2CCN(c3nc4ccncc4nc3NCC(F)F)CC2)c(F)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20F4N6.C2HF3O2/c21-14-2-1-13(15(22)9-14)12-29-5-7-30(8-6-29)20-19(26-11-18(23)24)27-17-10-25-4-3-16(17)28-20;3-2(4,5)1(6)7/h1-4,9-10,18H,5-8,11-12H2,(H,26,27);(H,6,7) |
| InChIKey | XUYKGXUHUPGVHT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |