About 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one
2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one (PubChem CID 127024483) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one |
| PubChem CID | 127024483 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C2CCCCC2)[nH]c(=O)c1.NCCO |
| InChI | InChI=1S/C12H17NO.C2H7NO/c1-9-7-11(13-12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10H,2-6H2,1H3,(H,13,14);4H,1-3H2 |
| InChIKey | YRPKZTNDPKMEPQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one?
The IUPAC name of 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one (CID 127024483) is 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one.
What is the SMILES notation for 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one?
The canonical SMILES for 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one is Cc1cc(C2CCCCC2)[nH]c(=O)c1.NCCO.
What is the InChIKey of 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one?
The InChIKey is YRPKZTNDPKMEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C2H7NO/c1-9-7-11(13-12(14)8-9)10-5-3-2-4-6-10;3-1-2-4/h7-8,10H,2-6H2,1H3,(H,13,14);4H,1-3H2.
What are the key properties of 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one?
2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one has a molecular weight of 252.36 g/mol, XLogP of 1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;6-cyclohexyl-4-methyl-1H-pyridin-2-one is sourced from PubChem (CID 127024483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).