About methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate
methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate (PubChem CID 127024686) has the molecular formula C17H19N5O2
and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate |
| PubChem CID | 127024686 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3nc(N)nc(N4CCCCC4)c3c2c1 |
| InChI | InChI=1S/C17H19N5O2/c1-24-16(23)10-5-6-12-11(9-10)13-14(19-12)20-17(18)21-15(13)22-7-3-2-4-8-22/h5-6,9H,2-4,7-8H2,1H3,(H3,18,19,20,21) |
| InChIKey | SKVGFVZDRLZIEY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate?
The IUPAC name of methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate (CID 127024686) is methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate.
What is the SMILES notation for methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate?
The canonical SMILES for methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate is COC(=O)c1ccc2[nH]c3nc(N)nc(N4CCCCC4)c3c2c1.
What is the InChIKey of methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate?
The InChIKey is SKVGFVZDRLZIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O2/c1-24-16(23)10-5-6-12-11(9-10)13-14(19-12)20-17(18)21-15(13)22-7-3-2-4-8-22/h5-6,9H,2-4,7-8H2,1H3,(H3,18,19,20,21).
What are the key properties of methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate?
methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate has a molecular weight of 325.37 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-piperidin-1-yl-9H-pyrimido[4,5-b]indole-6-carboxylate is sourced from PubChem (CID 127024686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).