C24H19F3N2O5S — CID 127024730
2-ethoxy-N-[3-oxo-2-[3-(trifluoromethylsulfonyl)phenyl]-1H-isoindol-4-yl]benzamide (PubChem CID 127024730) has the molecular formula C24H19F3N2O5S and a molecular weight of 504.49 g/mol. Its IUPAC name is 2-ethoxy-N-[3-oxo-2-[3-(trifluoromethylsulfonyl)phenyl]-1H-isoindol-4-yl]benzamide.
| Compound Name | 2-ethoxy-N-[3-oxo-2-[3-(trifluoromethylsulfonyl)phenyl]-1H-isoindol-4-yl]benzamide |
|---|---|
| PubChem CID | 127024730 |
| Molecular Formula | C24H19F3N2O5S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-ethoxy-N-[3-oxo-2-[3-(trifluoromethylsulfonyl)phenyl]-1H-isoindol-4-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1cccc2c1C(=O)N(c1cccc(S(=O)(=O)C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C24H19F3N2O5S/c1-2-34-20-12-4-3-10-18(20)22(30)28-19-11-5-7-15-14-29(23(31)21(15)19)16-8-6-9-17(13-16)35(32,33)24(25,26)27/h3-13H,2,14H2,1H3,(H,28,30) |
| InChIKey | HQELSSANPWBCNN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |