C25H21F6N7O2 — CID 127024758
N-pyridin-3-yl-2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 127024758) has the molecular formula C25H21F6N7O2 and a molecular weight of 565.48 g/mol. Its IUPAC name is N-pyridin-3-yl-2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-pyridin-3-yl-2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024758 |
| Molecular Formula | C25H21F6N7O2 |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | N-pyridin-3-yl-2-[4-[(2,4,5-trifluorophenyl)methyl]piperazin-1-yl]pyrido[3,4-b]pyrazin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cc(F)c(CN2CCN(c3nc4ccncc4nc3Nc3cccnc3)CC2)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H20F3N7.C2HF3O2/c24-17-11-19(26)18(25)10-15(17)14-32-6-8-33(9-7-32)23-22(29-16-2-1-4-27-12-16)30-21-13-28-5-3-20(21)31-23;3-2(4,5)1(6)7/h1-5,10-13H,6-9,14H2,(H,29,30);(H,6,7) |
| InChIKey | SYDKIDKHGWVTBL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|