C26H25Cl2F3N8O2 — CID 127024765
3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)quinoxalin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 127024765) has the molecular formula C26H25Cl2F3N8O2 and a molecular weight of 609.44 g/mol. Its IUPAC name is 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)quinoxalin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)quinoxalin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127024765 |
| Molecular Formula | C26H25Cl2F3N8O2 |
| Molecular Weight | 609.44 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 3-[4-[(2,5-dichlorophenyl)methyl]piperazin-1-yl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)quinoxalin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nnc(Nc2nc3ccccc3nc2N2CCN(Cc3cc(Cl)ccc3Cl)CC2)nc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24Cl2N8.C2HF3O2/c1-15-16(2)31-32-24(27-15)30-22-23(29-21-6-4-3-5-20(21)28-22)34-11-9-33(10-12-34)14-17-13-18(25)7-8-19(17)26;3-2(4,5)1(6)7/h3-8,13H,9-12,14H2,1-2H3,(H,27,28,30,32);(H,6,7) |
| InChIKey | HTZZNAZMTAGISL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |