C33H52N4O2S — CID 127024889
S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] (Z)-octadec-9-enethioate (PubChem CID 127024889) has the molecular formula C33H52N4O2S and a molecular weight of 568.87 g/mol. Its IUPAC name is S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] (Z)-octadec-9-enethioate.
| Compound Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] (Z)-octadec-9-enethioate |
|---|---|
| PubChem CID | 127024889 |
| Molecular Formula | C33H52N4O2S |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] (Z)-octadec-9-enethioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)SCCCCCCNC(=O)c1cc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C33H52N4O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-32(38)40-27-20-17-16-19-24-35-33(39)31-28-30(36-37-31)29-22-25-34-26-23-29/h9-10,22-23,25-26,28H,2-8,11-21,24,27H2,1H3,(H,35,39)(H,36,37)/b10-9- |
| InChIKey | MMRZASLWBSWGHB-KTKRTIGZSA-N |
| XLogP | 9.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|