C19H24N4O3S — CID 127024890
prop-2-enyl 6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexylsulfanylformate (PubChem CID 127024890) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is prop-2-enyl 6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexylsulfanylformate.
| Compound Name | prop-2-enyl 6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexylsulfanylformate |
|---|---|
| PubChem CID | 127024890 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | prop-2-enyl 6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexylsulfanylformate |
| SMILES | C=CCOC(=O)SCCCCCCNC(=O)c1cc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C19H24N4O3S/c1-2-12-26-19(25)27-13-6-4-3-5-9-21-18(24)17-14-16(22-23-17)15-7-10-20-11-8-15/h2,7-8,10-11,14H,1,3-6,9,12-13H2,(H,21,24)(H,22,23) |
| InChIKey | GSQASSTVDNRHSK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|