C23H28ClN5O — CID 127024891
3-[(E)-[6-[(dimethylamino)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 127024891) has the molecular formula C23H28ClN5O and a molecular weight of 425.96 g/mol. Its IUPAC name is 3-[(E)-[6-[(dimethylamino)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-[(E)-[6-[(dimethylamino)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127024891 |
| Molecular Formula | C23H28ClN5O |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-[(E)-[6-[(dimethylamino)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxy-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCO/N=C1\c2ccccc2-c2nc3c(CN(C)C)cccc3nc21.Cl |
| InChI | InChI=1S/C23H27N5O.ClH/c1-27(2)13-8-14-29-26-22-18-11-6-5-10-17(18)21-23(22)24-19-12-7-9-16(15-28(3)4)20(19)25-21;/h5-7,9-12H,8,13-15H2,1-4H3;1H/b26-22+; |
| InChIKey | BGPRLOKZSVUXFS-LIUXSCBKSA-N |
| XLogP | 3.81 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|